C35H31BrN2O5S — CID 50873715
[2-bromo-4-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenyl] adamantane-1-carboxylate (PubChem CID 50873715) has the molecular formula C35H31BrN2O5S and a molecular weight of 671.61 g/mol. Its IUPAC name is [2-bromo-4-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenyl] adamantane-1-carboxylate.
| Compound Name | [2-bromo-4-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 50873715 |
| Molecular Formula | C35H31BrN2O5S |
| Molecular Weight | 671.61 g/mol |
| Exact Mass | 670.11 |
| IUPAC Name | [2-bromo-4-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenyl] adamantane-1-carboxylate |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)cc(Br)c1OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H31BrN2O5S/c1-42-29-17-21(16-28(36)30(29)43-33(41)35-18-22-12-23(19-35)14-24(13-22)20-35)15-27-31(39)37(25-8-4-2-5-9-25)34(44)38(32(27)40)26-10-6-3-7-11-26/h2-11,15-17,22-24H,12-14,18-20H2,1H3 |
| InChIKey | LWDZZDDLWSRZSN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|