C20H13ClN2O4S2 — CID 2176764
[1-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]naphthalen-2-yl] 4-chlorobenzenesulfonate (PubChem CID 2176764) has the molecular formula C20H13ClN2O4S2 and a molecular weight of 444.92 g/mol. Its IUPAC name is [1-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]naphthalen-2-yl] 4-chlorobenzenesulfonate.
| Compound Name | [1-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]naphthalen-2-yl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2176764 |
| Molecular Formula | C20H13ClN2O4S2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [1-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]naphthalen-2-yl] 4-chlorobenzenesulfonate |
| SMILES | NC1=NC(=O)/C(=C/c2c(OS(=O)(=O)c3ccc(Cl)cc3)ccc3ccccc23)S1 |
| InChI | InChI=1S/C20H13ClN2O4S2/c21-13-6-8-14(9-7-13)29(25,26)27-17-10-5-12-3-1-2-4-15(12)16(17)11-18-19(24)23-20(22)28-18/h1-11H,(H2,22,23,24)/b18-11- |
| InChIKey | FEHMXDAYPYUNLI-WQRHYEAKSA-N |
| XLogP | 4.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|