C17H16N2O2S — CID 2934822
2-amino-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 2934822) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-amino-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2934822 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-amino-5-[(2-propoxynaphthalen-1-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCCOc1ccc2ccccc2c1C=C1SC(N)=NC1=O |
| InChI | InChI=1S/C17H16N2O2S/c1-2-9-21-14-8-7-11-5-3-4-6-12(11)13(14)10-15-16(20)19-17(18)22-15/h3-8,10H,2,9H2,1H3,(H2,18,19,20) |
| InChIKey | JQNJWCCOPGIBEW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|