C22H21N3O2S2 — CID 124577335
(2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(2-propoxynaphthalen-1-yl)methylidene]thiolan-3-one (PubChem CID 124577335) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(2-propoxynaphthalen-1-yl)methylidene]thiolan-3-one.
| Compound Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(2-propoxynaphthalen-1-yl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 124577335 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(2-propoxynaphthalen-1-yl)methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2c(OCCC)ccc3ccccc23)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C22H21N3O2S2/c1-3-11-27-16-10-9-13-7-5-6-8-14(13)15(16)12-17-20(26)19(21(23)28-17)22-25-24-18(4-2)29-22/h5-10,12,19,23H,3-4,11H2,1-2H3/b17-12-,23-21-/t19-/m1/s1 |
| InChIKey | WWVHKLBISOKRDG-DZRHKYJKSA-N |
| XLogP | 5.46 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|