C24H20N4OS2 — CID 3952949
2-[(1-benzylindol-3-yl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 3952949) has the molecular formula C24H20N4OS2 and a molecular weight of 444.59 g/mol. Its IUPAC name is 2-[(1-benzylindol-3-yl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | 2-[(1-benzylindol-3-yl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 3952949 |
| Molecular Formula | C24H20N4OS2 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[(1-benzylindol-3-yl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2cn(Cc3ccccc3)c3ccccc23)C(=O)C1c1nnc(CC)s1 |
| InChI | InChI=1S/C24H20N4OS2/c1-2-20-26-27-24(31-20)21-22(29)19(30-23(21)25)12-16-14-28(13-15-8-4-3-5-9-15)18-11-7-6-10-17(16)18/h3-12,14,21,25H,2,13H2,1H3/b19-12?,25-23- |
| InChIKey | ITBAVBBDPGOBRV-CPELJBIMSA-N |
| XLogP | 5.52 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|