C23H24N4OS2 — CID 124577923
(2Z,4S)-2-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 124577923) has the molecular formula C23H24N4OS2 and a molecular weight of 436.61 g/mol. Its IUPAC name is (2Z,4S)-2-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-2-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 124577923 |
| Molecular Formula | C23H24N4OS2 |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (2Z,4S)-2-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(C)n(-c3cccc(C)c3C)c2C)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C23H24N4OS2/c1-6-19-25-26-23(30-19)20-21(28)18(29-22(20)24)11-16-10-13(3)27(15(16)5)17-9-7-8-12(2)14(17)4/h7-11,20,24H,6H2,1-5H3/b18-11-,24-22-/t20-/m0/s1 |
| InChIKey | FQQPVXOSDRGSML-VZAJOLQZSA-N |
| XLogP | 5.54 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|