C22H21N3OS2 — CID 4235148
2-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 4235148) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 2-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 4235148 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2cc(C)n(-c3c(C)cccc3C)c2C)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C22H21N3OS2/c1-12-6-5-7-13(2)19(12)25-14(3)10-16(15(25)4)11-17-20(26)18(21(23)28-17)22-24-8-9-27-22/h5-11,18,23H,1-4H3/b17-11?,23-21- |
| InChIKey | QSJPNKFTBWQZKS-DYPXLOAOSA-N |
| XLogP | 5.59 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|