C14H8Cl2N2OS2 — CID 3598129
2-[(2,4-dichlorophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 3598129) has the molecular formula C14H8Cl2N2OS2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 3598129 |
| Molecular Formula | C14H8Cl2N2OS2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(Cl)cc2Cl)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C14H8Cl2N2OS2/c15-8-2-1-7(9(16)6-8)5-10-12(19)11(13(17)21-10)14-18-3-4-20-14/h1-6,11,17H/b10-5?,17-13- |
| InChIKey | NESHSZKCFWCNAH-SDYFBEICSA-N |
| XLogP | 4.87 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|