C16H14N2O3S2 — CID 3300070
2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 3300070) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 3300070 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-[(3-ethoxy-4-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(O)c(OCC)c2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C16H14N2O3S2/c1-2-21-11-7-9(3-4-10(11)19)8-12-14(20)13(15(17)23-12)16-18-5-6-22-16/h3-8,13,17,19H,2H2,1H3/b12-8?,17-15- |
| InChIKey | KKFYXPXGPHOXND-HPOKTBGBSA-N |
| XLogP | 3.67 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|