C18H16N2O5S2 — CID 124577320
2-[2-ethoxy-4-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid (PubChem CID 124577320) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124577320 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCC(=O)O)c(OCC)c2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C18H16N2O5S2/c1-2-24-12-7-10(3-4-11(12)25-9-14(21)22)8-13-16(23)15(17(19)27-13)18-20-5-6-26-18/h3-8,15,19H,2,9H2,1H3,(H,21,22)/b13-8-,19-17-/t15-/m1/s1 |
| InChIKey | LOBZKJGASGFCFC-IJCONFDSSA-N |
| XLogP | 3.42 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|