C16H12N2O4S2 — CID 124576889
2-[3-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid (PubChem CID 124576889) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[3-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124576889 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-[3-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1\S/C(=C\c2cccc(OCC(=O)O)c2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C16H12N2O4S2/c17-15-13(16-18-4-5-23-16)14(21)11(24-15)7-9-2-1-3-10(6-9)22-8-12(19)20/h1-7,13,17H,8H2,(H,19,20)/b11-7-,17-15-/t13-/m1/s1 |
| InChIKey | KZAKAVHLOICVDB-IKTOFPCCSA-N |
| XLogP | 3.02 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|