C17H15N3O4S2 — CID 124576426
2-[3-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetic acid (PubChem CID 124576426) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[3-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124576426 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[3-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1\S/C(=C\c2cccc(OCC(=O)O)c2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-2-12-19-20-17(26-12)14-15(23)11(25-16(14)18)7-9-4-3-5-10(6-9)24-8-13(21)22/h3-7,14,18H,2,8H2,1H3,(H,21,22)/b11-7-,18-16-/t14-/m0/s1 |
| InChIKey | AAPJBVAZQTZMMQ-CBOXPUHRSA-N |
| XLogP | 2.98 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|