C25H25N3O5S2 — CID 126343478
(2Z,4R)-2-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 126343478) has the molecular formula C25H25N3O5S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is (2Z,4R)-2-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4R)-2-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 126343478 |
| Molecular Formula | C25H25N3O5S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | (2Z,4R)-2-[[4-[(2,5-dimethoxyphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3cc(OC)ccc3OC)c(OC)c2)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C25H25N3O5S2/c1-5-21-27-28-25(35-21)22-23(29)20(34-24(22)26)11-14-6-8-18(19(10-14)32-4)33-13-15-12-16(30-2)7-9-17(15)31-3/h6-12,22,26H,5,13H2,1-4H3/b20-11-,26-24-/t22-/m1/s1 |
| InChIKey | UDDJCNZTXGNERD-RVVQWRSPSA-N |
| XLogP | 5.12 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|