C17H14N4O2S2 — CID 124577180
2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 124577180) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 124577180 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[4-[(Z)-[(4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCC#N)cc2)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C17H14N4O2S2/c1-2-13-20-21-17(25-13)14-15(22)12(24-16(14)19)9-10-3-5-11(6-4-10)23-8-7-18/h3-6,9,14,19H,2,8H2,1H3/b12-9-,19-16-/t14-/m0/s1 |
| InChIKey | LQQDGPYTTZNIJU-ISBWHCMHSA-N |
| XLogP | 3.42 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|