C22H18N4O4S2 — CID 126339953
(2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]thiolan-3-one (PubChem CID 126339953) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]thiolan-3-one.
| Compound Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 126339953 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (2Z,4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3ccc([N+](=O)[O-])cc3)cc2)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C22H18N4O4S2/c1-2-18-24-25-22(32-18)19-20(27)17(31-21(19)23)11-13-5-9-16(10-6-13)30-12-14-3-7-15(8-4-14)26(28)29/h3-11,19,23H,2,12H2,1H3/b17-11-,23-21-/t19-/m1/s1 |
| InChIKey | DABBLMLGQNCQTF-XPQFFJJQSA-N |
| XLogP | 5.01 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|