C18H18N2O2S2 — CID 5032041
5-imino-2-[[4-(2-methylpropoxy)phenyl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 5032041) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-imino-2-[[4-(2-methylpropoxy)phenyl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 5-imino-2-[[4-(2-methylpropoxy)phenyl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 5032041 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-imino-2-[[4-(2-methylpropoxy)phenyl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(OCC(C)C)cc2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C18H18N2O2S2/c1-11(2)10-22-13-5-3-12(4-6-13)9-14-16(21)15(17(19)24-14)18-20-7-8-23-18/h3-9,11,15,19H,10H2,1-2H3/b14-9?,19-17- |
| InChIKey | YENKJFOXQKKQLW-REGWDOESSA-N |
| XLogP | 4.60 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|