C17H13BrN2O2S2 — CID 3253277
2-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 3253277) has the molecular formula C17H13BrN2O2S2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 2-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 2-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 3253277 |
| Molecular Formula | C17H13BrN2O2S2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 2-[(3-bromo-4-prop-2-enoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(OCC=C)c(Br)c2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C17H13BrN2O2S2/c1-2-6-22-12-4-3-10(8-11(12)18)9-13-15(21)14(16(19)24-13)17-20-5-7-23-17/h2-5,7-9,14,19H,1,6H2/b13-9?,19-16- |
| InChIKey | OXXNLEPLGIKPIM-ZEBZVXQVSA-N |
| XLogP | 4.89 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|