C17H13N3O3S2 — CID 4997159
2-[4-[[5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 4997159) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[4-[[5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[[5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 4997159 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-[4-[[5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | [H]/N=C1\SC(=Cc2ccc(OCC#N)c(OC)c2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C17H13N3O3S2/c1-22-12-8-10(2-3-11(12)23-6-4-18)9-13-15(21)14(16(19)25-13)17-20-5-7-24-17/h2-3,5,7-9,14,19H,6H2,1H3/b13-9?,19-16- |
| InChIKey | SCDKVCOCEDNQCC-ZEBZVXQVSA-N |
| XLogP | 3.47 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|