C22H18N2O3S2 — CID 4266000
5-imino-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 4266000) has the molecular formula C22H18N2O3S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-imino-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | 5-imino-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 4266000 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 5-imino-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(OCc3ccccc3)c(OC)c2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C22H18N2O3S2/c1-26-17-11-15(7-8-16(17)27-13-14-5-3-2-4-6-14)12-18-20(25)19(21(23)29-18)22-24-9-10-28-22/h2-12,19,23H,13H2,1H3/b18-12?,23-21- |
| InChIKey | RJBJVQJIDXNFJB-BREBDEHOSA-N |
| XLogP | 5.15 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|