C15H11BrN2O2S2 — CID 124577765
(2Z,4R)-2-[(3-bromo-4-methoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 124577765) has the molecular formula C15H11BrN2O2S2 and a molecular weight of 395.30 g/mol. Its IUPAC name is (2Z,4R)-2-[(3-bromo-4-methoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-2-[(3-bromo-4-methoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 124577765 |
| Molecular Formula | C15H11BrN2O2S2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | (2Z,4R)-2-[(3-bromo-4-methoxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OC)c(Br)c2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C15H11BrN2O2S2/c1-20-10-3-2-8(6-9(10)16)7-11-13(19)12(14(17)22-11)15-18-4-5-21-15/h2-7,12,17H,1H3/b11-7-,17-14-/t12-/m1/s1 |
| InChIKey | CGFGQQNHCLVLQD-JARJLSSISA-N |
| XLogP | 4.33 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|