C17H16N2O4S2 — CID 4314077
5-imino-4-(1,3-thiazol-2-yl)-2-[(3,4,5-trimethoxyphenyl)methylidene]thiolan-3-one (PubChem CID 4314077) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-imino-4-(1,3-thiazol-2-yl)-2-[(3,4,5-trimethoxyphenyl)methylidene]thiolan-3-one.
| Compound Name | 5-imino-4-(1,3-thiazol-2-yl)-2-[(3,4,5-trimethoxyphenyl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 4314077 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 5-imino-4-(1,3-thiazol-2-yl)-2-[(3,4,5-trimethoxyphenyl)methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2cc(OC)c(OC)c(OC)c2)C(=O)C1c1nccs1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-21-10-6-9(7-11(22-2)15(10)23-3)8-12-14(20)13(16(18)25-12)17-19-4-5-24-17/h4-8,13,18H,1-3H3/b12-8?,18-16- |
| InChIKey | GQKLAQOLSYSTDR-PACZVVEESA-N |
| XLogP | 3.59 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|