C17H14N2O2S2 — CID 124578082
(2Z,4R)-5-imino-2-[(4-prop-2-enoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 124578082) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is (2Z,4R)-5-imino-2-[(4-prop-2-enoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-5-imino-2-[(4-prop-2-enoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 124578082 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (2Z,4R)-5-imino-2-[(4-prop-2-enoxyphenyl)methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCC=C)cc2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C17H14N2O2S2/c1-2-8-21-12-5-3-11(4-6-12)10-13-15(20)14(16(18)23-13)17-19-7-9-22-17/h2-7,9-10,14,18H,1,8H2/b13-10-,18-16-/t14-/m1/s1 |
| InChIKey | AFMUNZGCGBSLOX-JTMPGGCXSA-N |
| XLogP | 4.13 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|