C15H12ClN3OS2 — CID 124576943
(2Z,4S)-2-[(2-chlorophenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 124576943) has the molecular formula C15H12ClN3OS2 and a molecular weight of 349.87 g/mol. Its IUPAC name is (2Z,4S)-2-[(2-chlorophenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-2-[(2-chlorophenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 124576943 |
| Molecular Formula | C15H12ClN3OS2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (2Z,4S)-2-[(2-chlorophenyl)methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2Cl)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C15H12ClN3OS2/c1-2-11-18-19-15(22-11)12-13(20)10(21-14(12)17)7-8-5-3-4-6-9(8)16/h3-7,12,17H,2H2,1H3/b10-7-,17-14-/t12-/m0/s1 |
| InChIKey | XONGZHNMCBUWMT-UBNODKKESA-N |
| XLogP | 4.17 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|