C13H10N4O4S2 — CID 3276261
4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-nitrofuran-2-yl)methylidene]thiolan-3-one (PubChem CID 3276261) has the molecular formula C13H10N4O4S2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-nitrofuran-2-yl)methylidene]thiolan-3-one.
| Compound Name | 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-nitrofuran-2-yl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 3276261 |
| Molecular Formula | C13H10N4O4S2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-2-[(5-nitrofuran-2-yl)methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc([N+](=O)[O-])o2)C(=O)C1c1nnc(CC)s1 |
| InChI | InChI=1S/C13H10N4O4S2/c1-2-8-15-16-13(23-8)10-11(18)7(22-12(10)14)5-6-3-4-9(21-6)17(19)20/h3-5,10,14H,2H2,1H3/b7-5?,14-12- |
| InChIKey | BSVLUFIPBDZJNC-WDMGTHKOSA-N |
| XLogP | 3.02 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|