C15H11I2N3O2S2 — CID 126343092
(2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]-5-iminothiolan-3-one (PubChem CID 126343092) has the molecular formula C15H11I2N3O2S2 and a molecular weight of 583.21 g/mol. Its IUPAC name is (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 126343092 |
| Molecular Formula | C15H11I2N3O2S2 |
| Molecular Weight | 583.21 g/mol |
| Exact Mass | 582.84 |
| IUPAC Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(I)cc(I)c2O)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C15H11I2N3O2S2/c1-2-10-19-20-15(24-10)11-13(22)9(23-14(11)18)4-6-3-7(16)5-8(17)12(6)21/h3-5,11,18,21H,2H2,1H3/b9-4-,18-14-/t11-/m0/s1 |
| InChIKey | RLUWEWHNVZAKQF-LMZODVQGSA-N |
| XLogP | 4.43 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|