C16H15N3O3S2 — CID 124576999
(2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]-5-iminothiolan-3-one (PubChem CID 124576999) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 124576999 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (2Z,4S)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cccc(OC)c2O)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C16H15N3O3S2/c1-3-11-18-19-16(24-11)12-14(21)10(23-15(12)17)7-8-5-4-6-9(22-2)13(8)20/h4-7,12,17,20H,3H2,1-2H3/b10-7-,17-15-/t12-/m0/s1 |
| InChIKey | XATIKRUNFMQJDD-SUCAPWJKSA-N |
| XLogP | 3.23 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|