C21H19ClN4OS2 — CID 124577964
(2Z,4S)-2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one (PubChem CID 124577964) has the molecular formula C21H19ClN4OS2 and a molecular weight of 443.00 g/mol. Its IUPAC name is (2Z,4S)-2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one.
| Compound Name | (2Z,4S)-2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
|---|---|
| PubChem CID | 124577964 |
| Molecular Formula | C21H19ClN4OS2 |
| Molecular Weight | 443.00 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (2Z,4S)-2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-iminothiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(C)n(-c3cccc(Cl)c3)c2C)C(=O)[C@@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C21H19ClN4OS2/c1-4-17-24-25-21(29-17)18-19(27)16(28-20(18)23)9-13-8-11(2)26(12(13)3)15-7-5-6-14(22)10-15/h5-10,18,23H,4H2,1-3H3/b16-9-,23-20-/t18-/m0/s1 |
| InChIKey | WTAFIAOERBNUDQ-ONSUVLJTSA-N |
| XLogP | 5.58 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.00 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|