C25H22N4O3S2 — CID 126343832
2-[[2-ethoxy-4-[(Z)-[(4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126343832) has the molecular formula C25H22N4O3S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[[2-ethoxy-4-[(Z)-[(4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-ethoxy-4-[(Z)-[(4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126343832 |
| Molecular Formula | C25H22N4O3S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[[2-ethoxy-4-[(Z)-[(4R)-4-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-imino-3-oxothiolan-2-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCc3ccccc3C#N)c(OCC)c2)C(=O)[C@H]1c1nnc(CC)s1 |
| InChI | InChI=1S/C25H22N4O3S2/c1-3-21-28-29-25(34-21)22-23(30)20(33-24(22)27)12-15-9-10-18(19(11-15)31-4-2)32-14-17-8-6-5-7-16(17)13-26/h5-12,22,27H,3-4,14H2,1-2H3/b20-12-,27-24-/t22-/m1/s1 |
| InChIKey | YIEGXEUZXNLXMU-LHGDAHLCSA-N |
| XLogP | 5.37 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|