C24H18ClN3OS2 — CID 126343872
(2Z,4R)-2-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 126343872) has the molecular formula C24H18ClN3OS2 and a molecular weight of 464.02 g/mol. Its IUPAC name is (2Z,4R)-2-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-2-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 126343872 |
| Molecular Formula | C24H18ClN3OS2 |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (2Z,4R)-2-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2c(C)n(Cc3ccc(Cl)cc3)c3ccccc23)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C24H18ClN3OS2/c1-14-18(12-20-22(29)21(23(26)31-20)24-27-10-11-30-24)17-4-2-3-5-19(17)28(14)13-15-6-8-16(25)9-7-15/h2-12,21,26H,13H2,1H3/b20-12-,26-23-/t21-/m1/s1 |
| InChIKey | ZMPYEPAPRRTQKZ-ADFNONFLSA-N |
| XLogP | 6.53 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|