C14H8Br2N2O2S2 — CID 126342489
(2Z,4R)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 126342489) has the molecular formula C14H8Br2N2O2S2 and a molecular weight of 460.17 g/mol. Its IUPAC name is (2Z,4R)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 126342489 |
| Molecular Formula | C14H8Br2N2O2S2 |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 457.84 |
| IUPAC Name | (2Z,4R)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5-imino-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc(Br)cc(Br)c2O)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C14H8Br2N2O2S2/c15-7-3-6(11(19)8(16)5-7)4-9-12(20)10(13(17)22-9)14-18-1-2-21-14/h1-5,10,17,19H/b9-4-,17-13-/t10-/m1/s1 |
| InChIKey | NTQWRRZHKXUBMB-FAWKAHGZSA-N |
| XLogP | 4.79 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|