C18H16N2O5S — CID 68964870
1-(1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-en-1-one (PubChem CID 68964870) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-en-1-one.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 68964870 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-en-1-one |
| SMILES | O=C(C=CNc1ccc(S(=O)(=O)CCO)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H16N2O5S/c21-11-12-26(23,24)14-7-5-13(6-8-14)19-10-9-16(22)18-20-15-3-1-2-4-17(15)25-18/h1-10,19,21H,11-12H2 |
| InChIKey | ZZIYJCRYFKXFBU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|