C18H16N2O3 — CID 110902173
3-(1,3-benzoxazol-2-yl)-N-[4-(2-hydroxyethyl)phenyl]prop-2-enamide (PubChem CID 110902173) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-[4-(2-hydroxyethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-[4-(2-hydroxyethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 110902173 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-[4-(2-hydroxyethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1nc2ccccc2o1)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C18H16N2O3/c21-12-11-13-5-7-14(8-6-13)19-17(22)9-10-18-20-15-3-1-2-4-16(15)23-18/h1-10,21H,11-12H2,(H,19,22) |
| InChIKey | DCVHBYSEUYNXEF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|