C22H16N2O2 — CID 78801989
(E)-3-(1,3-benzoxazol-2-yl)-N-(2-phenylphenyl)prop-2-enamide (PubChem CID 78801989) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-(2-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78801989 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2-phenylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H16N2O2/c25-21(14-15-22-24-19-12-6-7-13-20(19)26-22)23-18-11-5-4-10-17(18)16-8-2-1-3-9-16/h1-15H,(H,23,25)/b15-14+ |
| InChIKey | OJWLEEUPWCJPNJ-CCEZHUSRSA-N |
| XLogP | 5.15 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|