C21H20N2O2S — CID 32559438
(E)-3-(1,3-benzoxazol-2-yl)-N-(2-cyclopentylsulfanylphenyl)prop-2-enamide (PubChem CID 32559438) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-(2-cyclopentylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2-cyclopentylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 32559438 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2-cyclopentylsulfanylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C21H20N2O2S/c24-20(13-14-21-23-16-9-3-5-11-18(16)25-21)22-17-10-4-6-12-19(17)26-15-7-1-2-8-15/h3-6,9-15H,1-2,7-8H2,(H,22,24)/b14-13+ |
| InChIKey | OXMCQCYTNIJLET-BUHFOSPRSA-N |
| XLogP | 5.51 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|