C19H17N3O3 — CID 36544732
(E)-3-(1,3-benzoxazol-2-yl)-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 36544732) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 36544732 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)/C=C/c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-20-18(24)12-13-6-8-14(9-7-13)21-17(23)10-11-19-22-15-4-2-3-5-16(15)25-19/h2-11H,12H2,1H3,(H,20,24)(H,21,23)/b11-10+ |
| InChIKey | ACOVEIPGNWHESH-ZHACJKMWSA-N |
| XLogP | 2.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|