C21H27BN2O2 — CID 142172636
N-[4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]phenyl]-1,3-benzoxazol-2-amine (PubChem CID 142172636) has the molecular formula C21H27BN2O2 and a molecular weight of 350.27 g/mol. Its IUPAC name is N-[4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]phenyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]phenyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 142172636 |
| Molecular Formula | C21H27BN2O2 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-[4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]phenyl]-1,3-benzoxazol-2-amine |
| SMILES | CB(OC(C)(C)C(C)(C)C)c1ccc(Nc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H27BN2O2/c1-20(2,3)21(4,5)26-22(6)15-11-13-16(14-12-15)23-19-24-17-9-7-8-10-18(17)25-19/h7-14H,1-6H3,(H,23,24) |
| InChIKey | PVYZFSNHWHSNRC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|