About formamide;2-methylsulfonyl-1,3-benzoxazole
formamide;2-methylsulfonyl-1,3-benzoxazole (PubChem CID 67836610) has the molecular formula C9H10N2O4S
and a molecular weight of 242.26 g/mol. Its IUPAC name is formamide;2-methylsulfonyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | formamide;2-methylsulfonyl-1,3-benzoxazole |
| PubChem CID | 67836610 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | formamide;2-methylsulfonyl-1,3-benzoxazole |
| SMILES | CS(=O)(=O)c1nc2ccccc2o1.NC=O |
| InChI | InChI=1S/C8H7NO3S.CH3NO/c1-13(10,11)8-9-6-4-2-3-5-7(6)12-8;2-1-3/h2-5H,1H3;1H,(H2,2,3) |
| InChIKey | XROITOBKIGGYBZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;2-methylsulfonyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;2-methylsulfonyl-1,3-benzoxazole?
The IUPAC name of formamide;2-methylsulfonyl-1,3-benzoxazole (CID 67836610) is formamide;2-methylsulfonyl-1,3-benzoxazole.
What is the SMILES notation for formamide;2-methylsulfonyl-1,3-benzoxazole?
The canonical SMILES for formamide;2-methylsulfonyl-1,3-benzoxazole is CS(=O)(=O)c1nc2ccccc2o1.NC=O.
What is the InChIKey of formamide;2-methylsulfonyl-1,3-benzoxazole?
The InChIKey is XROITOBKIGGYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S.CH3NO/c1-13(10,11)8-9-6-4-2-3-5-7(6)12-8;2-1-3/h2-5H,1H3;1H,(H2,2,3).
What are the key properties of formamide;2-methylsulfonyl-1,3-benzoxazole?
formamide;2-methylsulfonyl-1,3-benzoxazole has a molecular weight of 242.26 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;2-methylsulfonyl-1,3-benzoxazole is sourced from PubChem (CID 67836610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).