C9H10N2O4S — CID 67836610
formamide;2-methylsulfonyl-1,3-benzoxazole (PubChem CID 67836610) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is formamide;2-methylsulfonyl-1,3-benzoxazole.
| Compound Name | formamide;2-methylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 67836610 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | formamide;2-methylsulfonyl-1,3-benzoxazole |
| SMILES | CS(=O)(=O)c1nc2ccccc2o1.NC=O |
| InChI | InChI=1S/C8H7NO3S.CH3NO/c1-13(10,11)8-9-6-4-2-3-5-7(6)12-8;2-1-3/h2-5H,1H3;1H,(H2,2,3) |
| InChIKey | XROITOBKIGGYBZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|