C20H15NO3S — CID 86302472
2-[2-(4-methylsulfonylphenyl)phenyl]-1,3-benzoxazole (PubChem CID 86302472) has the molecular formula C20H15NO3S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonylphenyl)phenyl]-1,3-benzoxazole.
| Compound Name | 2-[2-(4-methylsulfonylphenyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 86302472 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[2-(4-methylsulfonylphenyl)phenyl]-1,3-benzoxazole |
| SMILES | CS(=O)(=O)c1ccc(-c2ccccc2-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H15NO3S/c1-25(22,23)15-12-10-14(11-13-15)16-6-2-3-7-17(16)20-21-18-8-4-5-9-19(18)24-20/h2-13H,1H3 |
| InChIKey | TWACCSCUXLTNIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |