C26H21N3O5S — CID 173403814
5,8-bis(1,3-benzoxazol-2-yl)naphthalene-2-sulfonic acid;N-methylmethanamine (PubChem CID 173403814) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is 5,8-bis(1,3-benzoxazol-2-yl)naphthalene-2-sulfonic acid;N-methylmethanamine.
| Compound Name | 5,8-bis(1,3-benzoxazol-2-yl)naphthalene-2-sulfonic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 173403814 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 5,8-bis(1,3-benzoxazol-2-yl)naphthalene-2-sulfonic acid;N-methylmethanamine |
| SMILES | CNC.O=S(=O)(O)c1ccc2c(-c3nc4ccccc4o3)ccc(-c3nc4ccccc4o3)c2c1 |
| InChI | InChI=1S/C24H14N2O5S.C2H7N/c27-32(28,29)14-9-10-15-16(23-25-19-5-1-3-7-21(19)30-23)11-12-17(18(15)13-14)24-26-20-6-2-4-8-22(20)31-24;1-3-2/h1-13H,(H,27,28,29);3H,1-2H3 |
| InChIKey | LCNANZVAKOTCPL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|