C18H11NO6S — CID 169335630
3-(1,3-benzoxazol-2-yl)-4-(5-formylfuran-2-yl)benzenesulfonic acid (PubChem CID 169335630) has the molecular formula C18H11NO6S and a molecular weight of 369.35 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-4-(5-formylfuran-2-yl)benzenesulfonic acid.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-4-(5-formylfuran-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 169335630 |
| Molecular Formula | C18H11NO6S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-4-(5-formylfuran-2-yl)benzenesulfonic acid |
| SMILES | O=Cc1ccc(-c2ccc(S(=O)(=O)O)cc2-c2nc3ccccc3o2)o1 |
| InChI | InChI=1S/C18H11NO6S/c20-10-11-5-8-16(24-11)13-7-6-12(26(21,22)23)9-14(13)18-19-15-3-1-2-4-17(15)25-18/h1-10H,(H,21,22,23) |
| InChIKey | HXSXHHAMVICXKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|