C15H10O9S2 — CID 169331896
4-(5-formylfuran-2-yl)-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 169331896) has the molecular formula C15H10O9S2 and a molecular weight of 398.37 g/mol. Its IUPAC name is 4-(5-formylfuran-2-yl)-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-(5-formylfuran-2-yl)-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 169331896 |
| Molecular Formula | C15H10O9S2 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 4-(5-formylfuran-2-yl)-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=Cc1ccc(-c2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)o1 |
| InChI | InChI=1S/C15H10O9S2/c16-7-9-1-2-14(24-9)12-5-10(25(18,19)20)3-8-4-11(26(21,22)23)6-13(17)15(8)12/h1-7,17H,(H,18,19,20)(H,21,22,23) |
| InChIKey | GFVUMCCQQFXNDB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|