C21H20O5S2 — CID 169334922
3-(4-tert-butylphenyl)sulfanyl-4-(5-formylfuran-2-yl)benzenesulfonic acid (PubChem CID 169334922) has the molecular formula C21H20O5S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfanyl-4-(5-formylfuran-2-yl)benzenesulfonic acid.
| Compound Name | 3-(4-tert-butylphenyl)sulfanyl-4-(5-formylfuran-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 169334922 |
| Molecular Formula | C21H20O5S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfanyl-4-(5-formylfuran-2-yl)benzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(Sc2cc(S(=O)(=O)O)ccc2-c2ccc(C=O)o2)cc1 |
| InChI | InChI=1S/C21H20O5S2/c1-21(2,3)14-4-7-16(8-5-14)27-20-12-17(28(23,24)25)9-10-18(20)19-11-6-15(13-22)26-19/h4-13H,1-3H3,(H,23,24,25) |
| InChIKey | XPJYIIJJKKNITH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|