C13H12O3 — CID 169333294
5-(2-hydroxy-4,5-dimethylphenyl)furan-2-carbaldehyde (PubChem CID 169333294) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-(2-hydroxy-4,5-dimethylphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(2-hydroxy-4,5-dimethylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333294 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 5-(2-hydroxy-4,5-dimethylphenyl)furan-2-carbaldehyde |
| SMILES | Cc1cc(O)c(-c2ccc(C=O)o2)cc1C |
| InChI | InChI=1S/C13H12O3/c1-8-5-11(12(15)6-9(8)2)13-4-3-10(7-14)16-13/h3-7,15H,1-2H3 |
| InChIKey | CKAOFKCKELLXJU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|