C13H11FO2 — CID 169335280
5-(3-fluoro-2,4-dimethylphenyl)furan-2-carbaldehyde (PubChem CID 169335280) has the molecular formula C13H11FO2 and a molecular weight of 218.23 g/mol. Its IUPAC name is 5-(3-fluoro-2,4-dimethylphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(3-fluoro-2,4-dimethylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335280 |
| Molecular Formula | C13H11FO2 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 5-(3-fluoro-2,4-dimethylphenyl)furan-2-carbaldehyde |
| SMILES | Cc1ccc(-c2ccc(C=O)o2)c(C)c1F |
| InChI | InChI=1S/C13H11FO2/c1-8-3-5-11(9(2)13(8)14)12-6-4-10(7-15)16-12/h3-7H,1-2H3 |
| InChIKey | AKQIZPOAIBBALM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|