C14H14O2 — CID 106886507
5-(2,4,5-trimethylphenyl)furan-2-carbaldehyde (PubChem CID 106886507) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 5-(2,4,5-trimethylphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(2,4,5-trimethylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106886507 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-(2,4,5-trimethylphenyl)furan-2-carbaldehyde |
| SMILES | Cc1cc(C)c(-c2ccc(C=O)o2)cc1C |
| InChI | InChI=1S/C14H14O2/c1-9-6-11(3)13(7-10(9)2)14-5-4-12(8-15)16-14/h4-8H,1-3H3 |
| InChIKey | IFIIDIPINKDPPU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|