C23H21N3O6S2 — CID 169330236
4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid (PubChem CID 169330236) has the molecular formula C23H21N3O6S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid.
| Compound Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 169330236 |
| Molecular Formula | C23H21N3O6S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-3-(4-tert-butylphenyl)sulfanylbenzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(Sc2cc(S(=O)(=O)O)ccc2-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C23H21N3O6S2/c1-23(2,3)12-4-6-13(7-5-12)33-17-10-14(34(30,31)32)8-9-16(17)26-18(27)11-15-19(20(26)24)22(29)25-21(15)28/h4-11H,24H2,1-3H3,(H,25,28,29)(H,30,31,32) |
| InChIKey | HGTRUYKSUGSKGI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|