C13H8ClN3O6S — CID 169331573
2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-chlorobenzenesulfonic acid (PubChem CID 169331573) has the molecular formula C13H8ClN3O6S and a molecular weight of 369.74 g/mol. Its IUPAC name is 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-chlorobenzenesulfonic acid.
| Compound Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 169331573 |
| Molecular Formula | C13H8ClN3O6S |
| Molecular Weight | 369.74 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-chlorobenzenesulfonic acid |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(Cl)cc1S(=O)(=O)O)C(=O)NC2=O |
| InChI | InChI=1S/C13H8ClN3O6S/c14-5-1-2-7(8(3-5)24(21,22)23)17-9(18)4-6-10(11(17)15)13(20)16-12(6)19/h1-4H,15H2,(H,16,19,20)(H,21,22,23) |
| InChIKey | OVTQVXPCXZBNKU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|