C10H8Na2O7S2 — CID 87126465
CID 87126465 (PubChem CID 87126465) has the molecular formula C10H8Na2O7S2 and a molecular weight of 350.28 g/mol.
| Compound Name | CID 87126465 |
|---|---|
| PubChem CID | 87126465 |
| Molecular Formula | C10H8Na2O7S2 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2c(O)cc(S(=O)(=O)O)cc2c1.[Na].[Na] |
| InChI | InChI=1S/C10H8O7S2.2Na/c11-10-5-8(19(15,16)17)4-6-3-7(18(12,13)14)1-2-9(6)10;;/h1-5,11H,(H,12,13,14)(H,15,16,17);; |
| InChIKey | VMCCJZMDNVPYDT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|