C10H7ClO7S2 — CID 86057490
3-chloro-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 86057490) has the molecular formula C10H7ClO7S2 and a molecular weight of 338.75 g/mol. Its IUPAC name is 3-chloro-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-chloro-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 86057490 |
| Molecular Formula | C10H7ClO7S2 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | 3-chloro-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(Cl)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H7ClO7S2/c11-8-4-7-5(2-10(8)20(16,17)18)1-6(3-9(7)12)19(13,14)15/h1-4,12H,(H,13,14,15)(H,16,17,18) |
| InChIKey | CQNFRXYXZUNPNZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|