C22H20N2O15S4 — CID 19105479
3-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid;3-amino-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 19105479) has the molecular formula C22H20N2O15S4 and a molecular weight of 680.67 g/mol. Its IUPAC name is 3-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid;3-amino-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid;3-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 19105479 |
| Molecular Formula | C22H20N2O15S4 |
| Molecular Weight | 680.67 g/mol |
| Exact Mass | 679.97 |
| IUPAC Name | 3-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid;3-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CC(=O)Nc1cc2c(O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O.Nc1cc2c(O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H11NO8S2.C10H9NO7S2/c1-6(14)13-10-5-9-7(3-12(10)23(19,20)21)2-8(4-11(9)15)22(16,17)18;11-8-4-7-5(2-10(8)20(16,17)18)1-6(3-9(7)12)19(13,14)15/h2-5,15H,1H3,(H,13,14)(H,16,17,18)(H,19,20,21);1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | VEQLBDLKEWFLCW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 313.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.67 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|